1-pyrrolidin-1-ylprop-2-yn-1-one structure
|
Common Name | 1-pyrrolidin-1-ylprop-2-yn-1-one | ||
|---|---|---|---|---|
| CAS Number | 82038-67-3 | Molecular Weight | 123.15200 | |
| Density | 1.106g/cm3 | Boiling Point | 186.3ºC at 760 mmHg | |
| Molecular Formula | C7H9NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 70ºC | |
| Name | 1-pyrrolidin-1-ylprop-2-yn-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.106g/cm3 |
|---|---|
| Boiling Point | 186.3ºC at 760 mmHg |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15200 |
| Flash Point | 70ºC |
| Exact Mass | 123.06800 |
| PSA | 20.31000 |
| LogP | 0.17990 |
| Index of Refraction | 1.517 |
| InChIKey | GYMKXYIJIPTPRG-UHFFFAOYSA-N |
| SMILES | C#CC(=O)N1CCCC1 |
|
~97%
1-pyrrolidin-1-... CAS#:82038-67-3 |
| Literature: UCB PHARMA S.A. Patent: WO2007/141504 A1, 2007 ; Location in patent: Page/Page column 65-66 ; WO 2007/141504 A1 |
|
~70%
1-pyrrolidin-1-... CAS#:82038-67-3 |
| Literature: Williamson, Bobby L.; Tykwinski, Rik R.; Stang, Peter J. Journal of the American Chemical Society, 1994 , vol. 116, # 1 p. 93 - 98 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-(pyrrolidin-1-yl)prop-2-yn-1-one |
| pyrrolidine,1-(1-oxo-2-propynyl) |
| 1-(1-Oxo-2-propynyl)pyrrolidine |
| 1-pyrrolidin-1-yl-propynone |
| pyrrolidyl propiolate |
| InChI=1/C7H9NO/c1-2-7(9)8-5-3-4-6-8/h1H,3-6H |
| 1-propioloylpyrrolidine |