2-Aminoflubendazole structure
|
Common Name | 2-Aminoflubendazole | ||
|---|---|---|---|---|
| CAS Number | 82050-13-3 | Molecular Weight | 255.24700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10FN3O | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of 2-Aminoflubendazole2-Aminoflubendazole is the metabolite of Benzimidazoles. Benzimidazoles (BZ) are a class of drugs with activities against fungi, protozoa, and helminthes[1][2]. |
| Name | (2-amino-3H-benzimidazol-5-yl)-(4-fluorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Description | 2-Aminoflubendazole is the metabolite of Benzimidazoles. Benzimidazoles (BZ) are a class of drugs with activities against fungi, protozoa, and helminthes[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C14H10FN3O |
|---|---|
| Molecular Weight | 255.24700 |
| Exact Mass | 255.08100 |
| PSA | 72.50000 |
| LogP | 2.44530 |
| InChIKey | WINHLTQNRABBSW-UHFFFAOYSA-N |
| SMILES | Nc1nc2ccc(C(=O)c3ccc(F)cc3)cc2[nH]1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| (2-Amino-1H-benzoimidazol-5-yl)-(4-fluoro-phenyl)-methanone |
| 2-Aminoflubendazole |
| Hydrolyzed flubendazole |
| Methanone,(2-amino-1H-benzimidazol-5-yl)(4-fluorophenyl) |
| 2-Amino-5-(4-fluorobenzoyl)-1H-benzimidazole |