n,o-bis(tert-butyldimethylsilyl)acetamide structure
|
Common Name | n,o-bis(tert-butyldimethylsilyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 82112-21-8 | Molecular Weight | 287.589 | |
| Density | 0.8±0.1 g/cm3 | Boiling Point | 283.8±23.0 °C at 760 mmHg | |
| Molecular Formula | C14H33NOSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.4±22.6 °C | |
| Name | [tert-butyl(dimethyl)silyl] N-[tert-butyl(dimethyl)silyl]ethanimidate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 283.8±23.0 °C at 760 mmHg |
| Molecular Formula | C14H33NOSi2 |
| Molecular Weight | 287.589 |
| Flash Point | 125.4±22.6 °C |
| Exact Mass | 287.210052 |
| PSA | 21.59000 |
| LogP | 5.61 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.423 |
| InChIKey | XFPQBAQQJIQJLY-UHFFFAOYSA-N |
| SMILES | CC(=N[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| Storage condition | 2-8°C |
| Hazard Codes | C |
|---|---|
| Risk Phrases | 34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 1760 8 / PGII |
| Packaging Group | III |
| HS Code | 2931900090 |
|
~%
n,o-bis(tert-bu... CAS#:82112-21-8 |
| Literature: Journal of Carbohydrates Nucleosides Nucleotides, , vol. 3, # 4 p. 197 - 227 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Ethanimidic acid, N-[(1,1-dimethylethyl)dimethylsilyl]-, (1,1-dimethylethyl)dimethylsilyl ester, (1E)- |
| b1906 |
| tert-Butyl(dimethyl)silyl (1E)-N-[tert-butyl(dimethyl)silyl]ethanimidoate |
| Dimethyl(2-methyl-2-propanyl)silyl (1E)-N-[dimethyl(2-methyl-2-propanyl)silyl]ethanimidate |