2,3-Difluoro-6-nitrophenol structure
|
Common Name | 2,3-Difluoro-6-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 82419-26-9 | Molecular Weight | 175.090 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 215.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C6H3F2NO3 | Melting Point | 60-62 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 84.4±25.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,3-difluoro-6-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 215.9±35.0 °C at 760 mmHg |
| Melting Point | 60-62 °C(lit.) |
| Molecular Formula | C6H3F2NO3 |
| Molecular Weight | 175.090 |
| Flash Point | 84.4±25.9 °C |
| Exact Mass | 175.008102 |
| PSA | 66.05000 |
| LogP | 2.00 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | KEGOHDCHURMFKX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(F)c(F)c1O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn,T,Xi |
| Risk Phrases | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed . R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2908999090 |
|
~85%
2,3-Difluoro-6-... CAS#:82419-26-9 |
| Literature: Hoechst Aktiengesellschaft Patent: US5292967 A1, 1994 ; |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Synthesis and fluorescent properties of 2-styryl-6, 7-difluoro-8-hydroxyquinoline and its Zn (II) complex. Nosova EV, et al.
J. Fluor. Chem. 150 , 36-38, (2013)
|
| WNR BQ CF DF |
| MFCD00042255 |
| 2,3-BUTANEDIONE-13C2 |
| Phenol, 2,3-difluoro-6-nitro- |
| 2-nitro-5,6-difluorophenol |
| 2-hydroxy-3,4-difluoro nitrobenzene |
| 6-Nitro-2,3-difluorophenol |
| 2,3-difluoro-6-nitro-phenol |
| 2,3-Difluoro-6-nitrophenol |
| 2,3-difluor-6-nitrophenol |
| 2,3-difluoro-6-nitrophenole |
| phenol,2,3-difluoro-6-nitro |