BIO-FARMA BF002831
Modify Date: 2025-11-25 13:00:50
BIO-FARMA BF002831 structure
|
Common Name | BIO-FARMA BF002831 | ||
|---|---|---|---|---|
| CAS Number | 824961-53-7 | Molecular Weight | 219.66700 | |
| Density | 1.18g/cm3 | Boiling Point | 360.8ºC at 760 mmHg | |
| Molecular Formula | C12H10ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172ºC | |
| Name | 5-(4-chlorophenyl)-1-methylpyrrole-2-carbaldehyde |
|---|
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 360.8ºC at 760 mmHg |
| Molecular Formula | C12H10ClNO |
| Molecular Weight | 219.66700 |
| Flash Point | 172ºC |
| Exact Mass | 219.04500 |
| PSA | 22.00000 |
| LogP | 3.15800 |
| Index of Refraction | 1.583 |
| InChIKey | DAQYSXUEFNMIPO-UHFFFAOYSA-N |
| SMILES | Cn1c(C=O)ccc1-c1ccc(Cl)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |