5-Methyl-1,3,4,6,9b-pentaazaphenalen-2-ylamine structure
|
Common Name | 5-Methyl-1,3,4,6,9b-pentaazaphenalen-2-ylamine | ||
|---|---|---|---|---|
| CAS Number | 82501-06-2 | Molecular Weight | 200.20000 | |
| Density | 1.7g/cm3 | Boiling Point | 378.4ºC at 760 mmHg | |
| Molecular Formula | C9H8N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.7ºC | |
| Name | 2-Amino-5-methyl-1,3,4,6,9b-pentaazaphenalene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7g/cm3 |
|---|---|
| Boiling Point | 378.4ºC at 760 mmHg |
| Molecular Formula | C9H8N6 |
| Molecular Weight | 200.20000 |
| Flash Point | 182.7ºC |
| Exact Mass | 200.08100 |
| PSA | 81.99000 |
| LogP | 1.14430 |
| Index of Refraction | 1.89 |
| InChIKey | DRZCTCPCYOUXQZ-UHFFFAOYSA-N |
| SMILES | CC1=Nc2nc(=N)nc3cccc(n23)N1 |
|
~72%
5-Methyl-1,3,4,... CAS#:82501-06-2 |
| Literature: Shaw, John T.; Coffindaffer, Timothy W.; Stimmel, Julie B.; Lindley, Patricia M. Journal of Heterocyclic Chemistry, 1982 , vol. 19, p. 357 - 361 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-Methyl-1,3,4,6,9b-pentaazaphenalen-2-ylamine |
| 5-Methyl-1,3,4,6,9b-pentaazaphenalen-2-amine |