4-(Methylsulfonyl)benzene-1-sulfonyl chloride
4-(Methylsulfonyl)benzene-1-sulfonyl chloride structure
|
Common Name | 4-(Methylsulfonyl)benzene-1-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 82964-91-8 | Molecular Weight | 254.71100 | |
| Density | 1.517g/cm3 | Boiling Point | 158-163°C | |
| Molecular Formula | C7H7ClO4S2 | Melting Point | 165-169 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 208.8ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 4-methylsulfonylbenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.517g/cm3 |
|---|---|
| Boiling Point | 158-163°C |
| Melting Point | 165-169 °C(lit.) |
| Molecular Formula | C7H7ClO4S2 |
| Molecular Weight | 254.71100 |
| Flash Point | 208.8ºC |
| Exact Mass | 253.94700 |
| PSA | 85.04000 |
| LogP | 3.17920 |
| Index of Refraction | 1.554 |
| InChIKey | TYJOQICPGZGYDT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)Cl)cc1 |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Phrases | R34 |
| Safety Phrases | S22-S26-S36/37/39-S45-S24/25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2904909090 |
|
~92%
4-(Methylsulfon... CAS#:82964-91-8 |
| Literature: Horner, Leopold; Schmitt, Rolf-Erhard Phosphorus and Sulfur and the Related Elements, 1982 , vol. 13, p. 189 - 212 |
|
~%
4-(Methylsulfon... CAS#:82964-91-8 |
| Literature: European Journal of Medicinal Chemistry, , vol. 36, # 10 p. 809 - 828 |
|
~%
4-(Methylsulfon... CAS#:82964-91-8 |
| Literature: European Journal of Medicinal Chemistry, , vol. 36, # 10 p. 809 - 828 |
|
~%
4-(Methylsulfon... CAS#:82964-91-8 |
| Literature: European Journal of Medicinal Chemistry, , vol. 36, # 10 p. 809 - 828 |
|
~%
4-(Methylsulfon... CAS#:82964-91-8 |
| Literature: European Journal of Medicinal Chemistry, , vol. 36, # 10 p. 809 - 828 |
![Acetamide,N-[4-(methylsulfonyl)phenyl]- structure](https://image.chemsrc.com/caspic/164/22821-80-3.png)
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Synthesis and biological evaluation of inhibitors of thymidine monophosphate kinase from Bacillus anthracis. Byun Y, et al.
Nucleosides Nucleotides Nucleic Acids 27(3) , 244-260, (2008)
|
| 4-methylsulfinylbenzenesulfonyl chloride |
| 4-(methylsulfonyl)benzene-1-sulfonyl chloride |
| 4-(methylsulphonyl)phenylsulphonyl chloride |
| 4-methanesulfonylbenzenesulfonyl chloride |
| MFCD00216486 |
| 4-(Methylsulfonyl)benzenesulfonyl chloride |
| 4-methanesulphonylbenzenesulphonyl chloride |
| 4-(methylsulphonyl)benzenesulphonyl chloride |