Propyl 7-ethyl-13-oxo-12,13-dihydro-7H-pyrrolo[2,1:6,1]pyrazino[2,3-c]carbazol-10-ylcarbamate structure
|
Common Name | Propyl 7-ethyl-13-oxo-12,13-dihydro-7H-pyrrolo[2,1:6,1]pyrazino[2,3-c]carbazol-10-ylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 82983-11-7 | Molecular Weight | 402.44600 | |
| Density | 1.38g/cm3 | Boiling Point | 488ºC at 760 mmHg | |
| Molecular Formula | C23H22N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.9ºC | |
| Name | nsc340564 |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 488ºC at 760 mmHg |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.44600 |
| Flash Point | 248.9ºC |
| Exact Mass | 402.16900 |
| PSA | 80.53000 |
| LogP | 4.94010 |
| Index of Refraction | 1.702 |
| InChIKey | UTEPRVPBNGEXAW-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)Nc1ccc2c(c1)c1c3[nH]c(=O)c4cccn4c3ccc1n2CC |
|
~%
Propyl 7-ethyl-... CAS#:82983-11-7 |
| Literature: Lancelot; Gazengel; Rault; Robba Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 5 p. 1674 - 1679 |
|
~%
Propyl 7-ethyl-... CAS#:82983-11-7 |
| Literature: Lancelot; Gazengel; Rault; Robba Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 5 p. 1674 - 1679 |
|
~51%
Propyl 7-ethyl-... CAS#:82983-11-7 |
| Literature: Lancelot; Gazengel; Rault; Robba Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 5 p. 1674 - 1679 |
|
~%
Propyl 7-ethyl-... CAS#:82983-11-7 |
| Literature: Lancelot; Gazengel; Rault; Robba Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 5 p. 1674 - 1679 |