dihydro-1,2-ethyl-9-isocyanato-12-oxo-2-pyrrolo<1',2':1,2>pyrazino<6,5-c>carbazole structure
|
Common Name | dihydro-1,2-ethyl-9-isocyanato-12-oxo-2-pyrrolo<1',2':1,2>pyrazino<6,5-c>carbazole | ||
|---|---|---|---|---|
| CAS Number | 82983-06-0 | Molecular Weight | 342.35100 | |
| Density | 1.44g/cm3 | Boiling Point | 446.9ºC at 760 mmHg | |
| Molecular Formula | C20H14N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.1ºC | |
| Name | dihydro-1,2-ethyl-9-isocyanato-12-oxo-2-pyrrolo<1',2':1,2>pyrazino<6,5-c>carbazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 446.9ºC at 760 mmHg |
| Molecular Formula | C20H14N4O2 |
| Molecular Weight | 342.35100 |
| Flash Point | 224.1ºC |
| Exact Mass | 342.11200 |
| PSA | 71.63000 |
| LogP | 3.87590 |
| Index of Refraction | 1.761 |
| InChIKey | RFZMWCMMOYDRMW-UHFFFAOYSA-N |
| SMILES | CCn1c2ccc(N=C=O)cc2c2c3[nH]c(=O)c4cccn4c3ccc21 |
|
~%
dihydro-1,2-eth... CAS#:82983-06-0 |
| Literature: Lancelot; Gazengel; Rault; Robba Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 5 p. 1674 - 1679 |
|
~%
dihydro-1,2-eth... CAS#:82983-06-0 |
| Literature: Lancelot; Gazengel; Rault; Robba Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 5 p. 1674 - 1679 |
|
~69%
dihydro-1,2-eth... CAS#:82983-06-0 |
| Literature: Lancelot; Gazengel; Rault; Robba Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 5 p. 1674 - 1679 |
| rfzmwcmmoydrmw-uhfffaoysa |