9H-Carbazole,9-ethyl-4,6-dinitro-3-(1H-pyrrol-1-yl)- structure
|
Common Name | 9H-Carbazole,9-ethyl-4,6-dinitro-3-(1H-pyrrol-1-yl)- | ||
|---|---|---|---|---|
| CAS Number | 82982-96-5 | Molecular Weight | 350.32800 | |
| Density | 1.46g/cm3 | Boiling Point | 532ºC at 760mmHg | |
| Molecular Formula | C18H14N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.5ºC | |
| Name | 9-ethyl-4,6-dinitro-3-pyrrol-1-ylcarbazole |
|---|
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 532ºC at 760mmHg |
| Molecular Formula | C18H14N4O4 |
| Molecular Weight | 350.32800 |
| Flash Point | 275.5ºC |
| Exact Mass | 350.10200 |
| PSA | 101.50000 |
| LogP | 5.46790 |
| Index of Refraction | 1.716 |
| InChIKey | APOFNLZDMOMXIO-UHFFFAOYSA-N |
| SMILES | CCn1c2ccc([N+](=O)[O-])cc2c2c([N+](=O)[O-])c(-n3cccc3)ccc21 |
|
~80%
9H-Carbazole,9-... CAS#:82982-96-5 |
| Literature: Lancelot; Gazengel; Rault; Robba Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 5 p. 1674 - 1679 |