nsc340563 structure
|
Common Name | nsc340563 | ||
|---|---|---|---|---|
| CAS Number | 82983-12-8 | Molecular Weight | 402.44600 | |
| Density | 1.39g/cm3 | Boiling Point | 483.3ºC at 760 mmHg | |
| Molecular Formula | C23H22N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.1ºC | |
| Name | nsc340563 |
|---|
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 483.3ºC at 760 mmHg |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.44600 |
| Flash Point | 246.1ºC |
| Exact Mass | 402.16900 |
| PSA | 80.53000 |
| LogP | 4.93850 |
| Index of Refraction | 1.703 |
| InChIKey | QVFJHDKCHBNCAV-UHFFFAOYSA-N |
| SMILES | CCn1c2ccc(NC(=O)OC(C)C)cc2c2c3[nH]c(=O)c4cccn4c3ccc21 |
|
~%
nsc340563 CAS#:82983-12-8 |
| Literature: Lancelot; Gazengel; Rault; Robba Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 5 p. 1674 - 1679 |
|
~%
nsc340563 CAS#:82983-12-8 |
| Literature: Lancelot; Gazengel; Rault; Robba Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 5 p. 1674 - 1679 |
|
~%
nsc340563 CAS#:82983-12-8 |
| Literature: Lancelot; Gazengel; Rault; Robba Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 5 p. 1674 - 1679 |
|
~40%
nsc340563 CAS#:82983-12-8 |
| Literature: Lancelot; Gazengel; Rault; Robba Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 5 p. 1674 - 1679 |