nsc340566 structure
|
Common Name | nsc340566 | ||
|---|---|---|---|---|
| CAS Number | 82996-74-5 | Molecular Weight | 416.47200 | |
| Density | 1.35g/cm3 | Boiling Point | 499.7ºC at 760 mmHg | |
| Molecular Formula | C24H24N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256ºC | |
| Name | nsc340566 |
|---|
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 499.7ºC at 760 mmHg |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.47200 |
| Flash Point | 256ºC |
| Exact Mass | 416.18500 |
| PSA | 80.53000 |
| LogP | 5.33020 |
| Index of Refraction | 1.69 |
| InChIKey | AQJYMFHCKWNPTM-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)Nc1ccc2c(c1)c1c3[nH]c(=O)c4cccn4c3ccc1n2CC |
|
~%
nsc340566 CAS#:82996-74-5 |
| Literature: Lancelot; Gazengel; Rault; Robba Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 5 p. 1674 - 1679 |
|
~%
nsc340566 CAS#:82996-74-5 |
| Literature: Lancelot; Gazengel; Rault; Robba Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 5 p. 1674 - 1679 |
|
~%
nsc340566 CAS#:82996-74-5 |
| Literature: Lancelot; Gazengel; Rault; Robba Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 5 p. 1674 - 1679 |
|
~39%
nsc340566 CAS#:82996-74-5 |
| Literature: Lancelot; Gazengel; Rault; Robba Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 5 p. 1674 - 1679 |