2-Thiophenecarbothioamide,3-amino-5-phenyl- structure
|
Common Name | 2-Thiophenecarbothioamide,3-amino-5-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 83060-70-2 | Molecular Weight | 234.34000 | |
| Density | 1.354g/cm3 | Boiling Point | 493.4ºC at 760mmHg | |
| Molecular Formula | C11H10N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.2ºC | |
| Name | 3-amino-5-phenylthiophene-2-carbothioamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.354g/cm3 |
|---|---|
| Boiling Point | 493.4ºC at 760mmHg |
| Molecular Formula | C11H10N2S2 |
| Molecular Weight | 234.34000 |
| Flash Point | 252.2ºC |
| Exact Mass | 234.02900 |
| PSA | 112.37000 |
| LogP | 3.91300 |
| Index of Refraction | 1.738 |
| InChIKey | UHTAQNUBHDLSCX-UHFFFAOYSA-N |
| SMILES | NC(=S)c1sc(-c2ccccc2)cc1N |
|
~87%
2-Thiophenecarb... CAS#:83060-70-2 |
| Literature: Wu-Yun Ren; Rao; Klein Journal of Heterocyclic Chemistry, 1986 , vol. 23, # 6 p. 1757 - 1763 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 3-amino-5-phenylthiophene-2-thiocarboxamide |