3,5-Di-O-(tert-butyldimethylsilyl)-2-deoxy-D-ribonolactone
3,5-Di-O-(tert-butyldimethylsilyl)-2-deoxy-D-ribonolactone structure
|
Common Name | 3,5-Di-O-(tert-butyldimethylsilyl)-2-deoxy-D-ribonolactone | ||
|---|---|---|---|---|
| CAS Number | 83159-91-5 | Molecular Weight | 360.63600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H36O4Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H36O4Si2 |
|---|---|
| Molecular Weight | 360.63600 |
| Exact Mass | 360.21500 |
| PSA | 44.76000 |
| LogP | 4.71410 |
| InChIKey | DCFHRVSQGCDCMH-UONOGXRCSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1OC(=O)CC1O[Si](C)(C)C(C)(C)C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 1 | |
CAS#:18162-48-6
CAS#:34371-14-7![(-)-(S)-3-((R)-2,2-dimethyl[1,3]dioxolan-4-yl)-3-hydroxypropanoic acid methyl ester Structure](https://image.chemsrc.com/caspic/257/83159-90-4.png)
CAS#:83159-90-4
CAS#:452-51-7
CAS#:83159-89-1
CAS#:167023-13-4
CAS#:210640-60-1
CAS#:173327-56-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD01630917 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one? |
| A: Related downstream products(CAS) of (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one: 173327-56-5. |
| Q: What are the upstream materials of (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one? |
| A: Related upstream materials(CAS) of (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one: 18162-48-6;34371-14-7;83159-90-4;452-51-7;83159-89-1;167023-13-4;210640-60-1. |
| Q: What is the polar surface area (PSA) of (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one? |
| A: Polar surface area (PSA) of (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one is 44.76000. |
| Q: What is the LogP of (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one? |
| A: LogP of (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one is 4.71410. |
| Q: What English synonyms does (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one have? |
| A: English synonyms of (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one: MFCD01630917. |
| Q: What is the molecular formula of (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one? |
| A: Molecular formula of (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one is C17H36O4Si2. |
| Q: What is the SMILES notation of (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one? |
| A: SMILES notation of (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one is CC(C)(C)[Si](C)(C)OCC1OC(=O)CC1O[Si](C)(C)C(C)(C)C. |
| Q: What is the CAS number of (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one? |
| A: CAS number of (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one is 83159-91-5. |
| Q: What is the molecular weight of (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one? |
| A: Molecular weight of (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one is 360.63600. |
| Q: What is the InChIKey of (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one? |
| A: InChIKey of (4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-one is DCFHRVSQGCDCMH-UONOGXRCSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |