Hexafluoro-2,2-diphenylpropane structure
|
Common Name | Hexafluoro-2,2-diphenylpropane | ||
|---|---|---|---|---|
| CAS Number | 83558-76-3 | Molecular Weight | 304.23000 | |
| Density | 1.37 | Boiling Point | 237.083ºC at 760 mmHg | |
| Molecular Formula | C15H10F6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 77.493ºC | |
| Name | Hexafluoro-2,2-diphenylpropane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37 |
|---|---|
| Boiling Point | 237.083ºC at 760 mmHg |
| Molecular Formula | C15H10F6 |
| Molecular Weight | 304.23000 |
| Flash Point | 77.493ºC |
| Exact Mass | 304.06900 |
| LogP | 5.09730 |
| Index of Refraction | 1.467 |
| InChIKey | CFTSORNHIUMCGF-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(c1ccccc1)(c1ccccc1)C(F)(F)F |
| HS Code | 2903999090 |
|---|
|
~97%
Hexafluoro-2,2-... CAS#:83558-76-3 |
| Literature: Kotsuki; Datta; Hayakawa; Suenaga Synthesis, 1995 , # 11 p. 1348 - 1350 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| (1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)benzene |