1-[4-(4-methylsulfonylphenoxy)phenyl]ethanone
Modify Date: 2025-08-25 19:28:53
![1-[4-(4-methylsulfonylphenoxy)phenyl]ethanone Structure](https://image.chemsrc.com/caspic/485/83642-22-2.png)
1-[4-(4-methylsulfonylphenoxy)phenyl]ethanone structure
|
Common Name | 1-[4-(4-methylsulfonylphenoxy)phenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 83642-22-2 | Molecular Weight | 290.33400 | |
| Density | 1.244g/cm3 | Boiling Point | 478ºC at 760 mmHg | |
| Molecular Formula | C15H14O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.9ºC | |
| Name | 1-[4-(4-methylsulfonylphenoxy)phenyl]ethanone |
|---|
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 478ºC at 760 mmHg |
| Molecular Formula | C15H14O4S |
| Molecular Weight | 290.33400 |
| Flash Point | 242.9ºC |
| Exact Mass | 290.06100 |
| PSA | 68.82000 |
| LogP | 4.16580 |
| Index of Refraction | 1.565 |
| InChIKey | CUDIIGGMJHXZLC-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(Oc2ccc(S(C)(=O)=O)cc2)cc1 |
|
Detail
|
| Literature: The Dow Chemical Company Patent: US4349568 A1, 1982 ; |
|
Name: Lowest concentration to reduce viral effect by 50% or more against Rhinovirus (RV)-2
Source: ChEMBL
Target: Enterovirus
External Id: CHEMBL799620
|
|
Name: Lowest concentration to reduce viral effect by 50% or more against Rhinovirus (RV)-1A
Source: ChEMBL
Target: Enterovirus
External Id: CHEMBL800917
|
|
Name: Ratio of the MIC50 of 6-(4-Nitro-phenoxy)-nicotinonitrile compared to compound obtain...
Source: ChEMBL
Target: Coxsackievirus
External Id: CHEMBL661536
|
|
Name: Cytotoxicity concentration in HeLa cells
Source: ChEMBL
Target: HeLa
External Id: CHEMBL641837
|
|
Name: Lowest concentration to reduce viral effect by 50% or more against coxsackie virus A2...
Source: ChEMBL
Target: Coxsackievirus
External Id: CHEMBL665061
|
|
Name: Ratio of the MIC50 of 6-(4-Nitro-phenoxy)-nicotinonitrile compared to compound obtain...
Source: ChEMBL
Target: Enterovirus
External Id: CHEMBL799621
|
Total 6, Current Page 1 of 1
1