6-anilino-1-naphthalenesulfonic acid structure
|
Common Name | 6-anilino-1-naphthalenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 83662-03-7 | Molecular Weight | 299.34400 | |
| Density | 1.409g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-anilinonaphthalene-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.409g/cm3 |
|---|---|
| Molecular Formula | C16H13NO3S |
| Molecular Weight | 299.34400 |
| Exact Mass | 299.06200 |
| PSA | 74.78000 |
| LogP | 4.98390 |
| Index of Refraction | 1.71 |
| InChIKey | RZKNDVLIIDRINE-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1cccc2cc(Nc3ccccc3)ccc12 |
| HS Code | 2921499090 |
|---|
|
~%
6-anilino-1-nap... CAS#:83662-03-7 |
| Literature: Lesser Chemische Berichte, 1894 , vol. 27, p. 2365 Full Text Show Details Clayton Aniline Co. Patent: DE53649 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 2, p. 266 |
|
~%
6-anilino-1-nap... CAS#:83662-03-7 |
| Literature: Bayer and Co. Patent: DE70349 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 513 |
|
~%
6-anilino-1-nap... CAS#:83662-03-7 |
| Literature: Bayer and Co. Patent: DE70349 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 513 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 6-Anilino-1-naphthalenesulfonic acid |
| 6-Anilino-naphthalin-1-sulfonsaeure |
| 6-anilino-naphthalene-1-sulfonic acid |
| 6-Ansa |