2,3-Dichloroanthraquinone structure
|
Common Name | 2,3-Dichloroanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 84-45-7 | Molecular Weight | 277.10200 | |
| Density | 1.514 g/cm3 | Boiling Point | 455.2ºC at 760 mmHg | |
| Molecular Formula | C14H6Cl2O2 | Melting Point | 267℃ | |
| MSDS | N/A | Flash Point | 191.7ºC | |
| Name | 2,3-dichloroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.514 g/cm3 |
|---|---|
| Boiling Point | 455.2ºC at 760 mmHg |
| Melting Point | 267℃ |
| Molecular Formula | C14H6Cl2O2 |
| Molecular Weight | 277.10200 |
| Flash Point | 191.7ºC |
| Exact Mass | 275.97400 |
| PSA | 34.14000 |
| LogP | 3.76880 |
| Index of Refraction | 1.671 |
| InChIKey | KPYPNTLKDIYIKB-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2cc(Cl)c(Cl)cc21 |
| HS Code | 2914700090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 5 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 9,2,3-dichloro |
| Anthraquinone,2,3-dichloro |
| 2,3-Dichlor-9,10-anthrachinon |
| 2,3-dichloro-9,10-anthracenedione |
| F0051-0092 |
| 2,3-dichloro-anthraquinone |
| 2,3-Dichlor-anthrachinon |
| 2,3-Dichloroanthrachinon |