1,3,3-Trimethyl-2-(formylmethylene)indoline structure
|
Common Name | 1,3,3-Trimethyl-2-(formylmethylene)indoline | ||
|---|---|---|---|---|
| CAS Number | 84-83-3 | Molecular Weight | 201.264 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 301.4±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H15NO | Melting Point | 112-116 °C(lit.) | |
| MSDS | USA | Flash Point | 107.2±17.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(1,3,3-Trimethylindolin-2-ylidene)acetaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 301.4±42.0 °C at 760 mmHg |
| Melting Point | 112-116 °C(lit.) |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.264 |
| Flash Point | 107.2±17.3 °C |
| Exact Mass | 201.115356 |
| PSA | 20.31000 |
| LogP | 2.67 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | GCECACVNILMTRD-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=O)C(C)(C)c2ccccc21 |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | AB2812500 |
| HS Code | 2933990090 |
|
~%
1,3,3-Trimethyl... CAS#:84-83-3 |
| Literature: US2126852 , ; DE615130 , ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 22, p. 336 |
|
~%
1,3,3-Trimethyl... CAS#:84-83-3 |
| Literature: Tetrahedron Letters, , vol. 37, # 29 p. 5127 - 5130 |
|
~%
1,3,3-Trimethyl... CAS#:84-83-3 |
| Literature: Chemische Berichte, , vol. 92, p. 1809,1810 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3,3-Trimethyl-2-(formylmethylene)indoline |
| MFCD00071813 |
| Acetaldehyde, 2-(1,3-dihydro-1,3,3-trimethyl-2H-indol-2-ylidene)-, (2Z)- |
| (2Z)-(1,3,3-Trimethyl-1,3-dihydro-2H-indol-2-ylidene)acetaldehyde |
| Acetaldehyde, 2-(1,3-dihydro-1,3,3-trimethyl-2H-indol-2-ylidene)-, (2E)- |
| Fischer's Aldehyde |
| EINECS 201-565-8 |
| (2E)-(1,3,3-Trimethyl-1,3-dihydro-2H-indol-2-ylidene)acetaldehyde |
| (2E)-(1,3,3-trimethyl-1,3-dihydro-2H-indol-2-ylidene)ethanal |