1'-Boc-1,2-dihydro-2-oxo-spiro[4H-3,1-benzoxazine-4,4'-piperidine] structure
|
Common Name | 1'-Boc-1,2-dihydro-2-oxo-spiro[4H-3,1-benzoxazine-4,4'-piperidine] | ||
|---|---|---|---|---|
| CAS Number | 84060-08-2 | Molecular Weight | 318.36800 | |
| Density | 1.25g/cm3 | Boiling Point | 415.2ºC at 760 mmHg | |
| Molecular Formula | C17H22N2O4 | Melting Point | 83-85ºC | |
| MSDS | N/A | Flash Point | 204.9ºC | |
| Name | 1'-Boc-1,2-dihydro-2-oxo-spiro[4H-3,1-benzoxazine-4,4'-piperidine] |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 415.2ºC at 760 mmHg |
| Melting Point | 83-85ºC |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.36800 |
| Flash Point | 204.9ºC |
| Exact Mass | 318.15800 |
| PSA | 67.87000 |
| LogP | 3.55080 |
| Index of Refraction | 1.584 |
| InChIKey | XJSGYDPAFSJFQE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)OC(=O)Nc1ccccc12 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934999090 |
|
~%
1'-Boc-1,2-dihy... CAS#:84060-08-2 |
| Literature: WO2008/21375 A2, ; Page/Page column 42-43 ; WO 2008/021375 A2 |
|
~%
1'-Boc-1,2-dihy... CAS#:84060-08-2 |
| Literature: Journal of Medicinal Chemistry, , vol. 26, # 5 p. 657 - 661 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 2-oxospiro[1H-3,1-benzoxazine-4,4'-piperidine]-1'-carboxylate |