spiro[benzo[d][1,3]oxazine-4,4'-piperidin]-2(1H)-one structure
|
Common Name | spiro[benzo[d][1,3]oxazine-4,4'-piperidin]-2(1H)-one | ||
|---|---|---|---|---|
| CAS Number | 84060-09-3 | Molecular Weight | 218.252 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 328.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.6±27.9 °C | |
| Name | Spiro[4H-3,1-benzoxazine-4,4'-piperidin]-2(1H)-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 328.8±42.0 °C at 760 mmHg |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.252 |
| Flash Point | 152.6±27.9 °C |
| Exact Mass | 218.105530 |
| PSA | 50.36000 |
| LogP | 1.84 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | NHUBGKMFTPUSRP-UHFFFAOYSA-N |
| SMILES | O=C1Nc2ccccc2C2(CCNCC2)O1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934999090 |
|
~83%
spiro[benzo[d][... CAS#:84060-09-3 |
| Literature: Clark; Caroon; Kluge; Repke; Roszkowski; Strosberg; Baker; Bitter; Okada Journal of Medicinal Chemistry, 1983 , vol. 26, # 5 p. 657 - 661 |
|
~%
spiro[benzo[d][... CAS#:84060-09-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 26, # 5 p. 657 - 661 |
|
~%
spiro[benzo[d][... CAS#:84060-09-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 26, # 5 p. 657 - 661 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| spiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one |
| Spiro[3,1-benzoxazine-4,4'-piperidin]-2(1H)-one |
| SPIRO[4H-3,1-BENZOXAZINE-4,4'-PIPERIDIN]-2(1H)-ONE |
| spiro[benzo[d][1,3]oxazine-4,4'-piperidin]-2(1H)-one |