Cibacron Blue 3G-A structure
|
Common Name | Cibacron Blue 3G-A | ||
|---|---|---|---|---|
| CAS Number | 84166-13-2 | Molecular Weight | 774.157 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C29H20ClN7O11S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cibacron Blue 3G-ACibacron Blue 3G-A is an anthraquinone dye, inhibits the R46 β-lactamase with a Ki value of 1.2 uM[1]. |
| Name | 1-amino-4-[4-[[4-chloro-6-(2-sulfoanilino)-1,3,5-triazin-2-yl]amino]-3-sulfoanilino]-9,10-dioxoanthracene-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Cibacron Blue 3G-A is an anthraquinone dye, inhibits the R46 β-lactamase with a Ki value of 1.2 uM[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: anthraquinone dye[1] |
| In Vitro | Cibacron Blue 3G-A is a structural analogy between the dye and NADH, it interacts with (di)nucleotide-dependent enzymes and can be a standard tool for studying their active sites[2]. |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Molecular Formula | C29H20ClN7O11S3 |
| Molecular Weight | 774.157 |
| Exact Mass | 773.007141 |
| PSA | 329.63000 |
| LogP | 1.19 |
| Index of Refraction | 1.785 |
| InChIKey | YKCWQPZFAFZLBI-UHFFFAOYSA-N |
| SMILES | Nc1c(S(=O)(=O)O)cc(Nc2ccc(Nc3nc(Cl)nc(Nc4ccccc4S(=O)(=O)O)n3)c(S(=O)(=O)O)c2)c2c1C(=O)c1ccccc1C2=O |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 26 |
| Cibacron Blue Agarose |
| Cibacron Blue |
| 1-Amino-4-{[4-({4-chloro-6-[(2-sulfophenyl)amino]-1,3,5-triazin-2-yl}amino)-3-sulfophenyl]amino}-9,10-dioxo-9,10-dihydro-2-anthracenesulfonic acid |
| 1-Amino-4-((4-((4-chloro-6-((sulfophenyl)amino)-1,3,5-triazin-2-yl)amino)-3-sulfophenyl)amino)-9,10-dihydro-9,10-dioxo-2-anthracenesulfonic acid |
| 1-Amino-4-{[4-({4-chloro-6-[(2-sulfophenyl)amino]-1,3,5-triazin-2-yl}amino)-3-sulfophenyl]amino}-9,10-dioxo-9,10-dihydroanthracene-2-sulfonic acid |
| 2-Anthracenesulfonic acid, 1-amino-4-[[4-[[4-chloro-6-[(2-sulfophenyl)amino]-1,3,5-triazin-2-yl]amino]-3-sulfophenyl]amino]-9,10-dihydro-9,10-dioxo- |
| Cibacron blue 3GA |
| 1-Amino-4-{[4-({4-chloro-6-[(2-sulfophenyl)amino]-1,3,5-triazin-2-yl}amino)-3-sulfophenyl]amino}-9,10-dioxo-9,10-dihydroanthracene-2-sulfonato(5-) |
| C9534_SIAL |