Methyl 4-Benzyloxy Cinnamate
Methyl 4-Benzyloxy Cinnamate structure
|
Common Name | Methyl 4-Benzyloxy Cinnamate | ||
|---|---|---|---|---|
| CAS Number | 84184-51-0 | Molecular Weight | 268.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H16O3 |
|---|---|
| Molecular Weight | 268.30700 |
| Exact Mass | 268.11000 |
| PSA | 35.53000 |
| LogP | 3.45180 |
| InChIKey | XQOAFLYGJKNOAR-FMIVXFBMSA-N |
| SMILES | COC(=O)C=Cc1ccc(OCc2ccccc2)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 5 | |
CAS#:3943-97-3
CAS#:54732-46-6![3-[4-(Benzyloxy)Phenyl]Acrylic Acid structure](https://image.chemsrc.com/caspic/045/6272-45-3.png)
CAS#:6272-45-3
CAS#:24807-40-7![[R-(R*,S*)]-β-[(1-Phenylethyl)(phenylmethyl)amino]-4-(phenylmethoxy)-benzenepropanoic Acid Methyl Ester structure](https://image.chemsrc.com/caspic/241/134430-95-8.png)
CAS#:134430-95-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-benzyloxy-trans-cinnamic acid methyl ester |
| Methyl 4-Benzyloxy Cinnamate |
| 4-benzyloxycinnamic acid methyl ester |
| 4-Benzyloxy-trans-zimtsaeure-methylester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of methyl (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate? |
| A: Molecular weight of methyl (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate is 268.30700. |
| Q: What English synonyms does methyl (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate have? |
| A: English synonyms of methyl (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate: 4-benzyloxy-trans-cinnamic acid methyl ester, Methyl 4-Benzyloxy Cinnamate, 4-benzyloxycinnamic acid methyl ester, 4-Benzyloxy-trans-zimtsaeure-methylester. |
| Q: What is the SMILES notation of methyl (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate? |
| A: SMILES notation of methyl (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate is COC(=O)C=Cc1ccc(OCc2ccccc2)cc1. |
| Q: What is the molecular formula of methyl (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate? |
| A: Molecular formula of methyl (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate is C17H16O3. |
| Q: What is the Chinese name of 84184-51-0? |
| A: Chinese name of 84184-51-0 is 84184-51-0. |
| Q: What is the CAS number of methyl (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate? |
| A: CAS number of methyl (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate is 84184-51-0. |
| Q: What are the downstream products of methyl (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate? |
| A: Related downstream products(CAS) of methyl (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate: 3943-97-3;54732-46-6;6272-45-3;24807-40-7;134430-95-8. |
| Q: What is the polar surface area (PSA) of methyl (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate? |
| A: Polar surface area (PSA) of methyl (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate is 35.53000. |
| Q: What is the InChIKey of methyl (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate? |
| A: InChIKey of methyl (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate is XQOAFLYGJKNOAR-FMIVXFBMSA-N. |
| Q: What is the LogP of methyl (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate? |
| A: LogP of methyl (E)-3-(4-phenylmethoxyphenyl)prop-2-enoate is 3.45180. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |