6,7-dichloro-1-oxidoquinolin-1-ium-5,8-dione structure
|
Common Name | 6,7-dichloro-1-oxidoquinolin-1-ium-5,8-dione | ||
|---|---|---|---|---|
| CAS Number | 84289-01-0 | Molecular Weight | 244.03100 | |
| Density | 1.72g/cm3 | Boiling Point | 450.1ºC at 760 mmHg | |
| Molecular Formula | C9H3Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226ºC | |
| Name | 6,7-dichloro-1-oxidoquinolin-1-ium-5,8-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.72g/cm3 |
|---|---|
| Boiling Point | 450.1ºC at 760 mmHg |
| Molecular Formula | C9H3Cl2NO3 |
| Molecular Weight | 244.03100 |
| Flash Point | 226ºC |
| Exact Mass | 242.94900 |
| PSA | 59.60000 |
| LogP | 2.18330 |
| Index of Refraction | 1.697 |
| InChIKey | YTBFFBZWASJMPJ-UHFFFAOYSA-N |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)c2c1ccc[n+]2[O-] |
|
~70%
6,7-dichloro-1-... CAS#:84289-01-0 |
| Literature: Mlochowski, Jacek; Kloc, Krystian; Piatkowska, Joanna Heterocycles, 1982 , vol. 19, # 10 p. 1889 - 1894 |
|
~%
6,7-dichloro-1-... CAS#:84289-01-0 |
| Literature: Shaikh; Johnson; Grollman Journal of Medicinal Chemistry, 1986 , vol. 29, # 8 p. 1329 - 1340 |
|
~10%
6,7-dichloro-1-... CAS#:84289-01-0 |
| Literature: Shaikh; Johnson; Grollman Journal of Medicinal Chemistry, 1986 , vol. 29, # 8 p. 1329 - 1340 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 6,7-Dichloro-5,8-quinolinedione 1-oxide |
| 6,7-dichloroquinoline-5,8-dione N-oxide |
| 6,7-dichloro-5,8-quinolinedione N-oxide |
| 5,8-Quinolinedione,6,7-dichloro-,1-oxide |