(S)-1-tert-Butyl 2-methyl 4-methylenepyrrolidine-1,2-dicarboxylate structure
|
Common Name | (S)-1-tert-Butyl 2-methyl 4-methylenepyrrolidine-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 84348-39-0 | Molecular Weight | 241.284 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 302.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.4±27.9 °C | |
| Name | (S)-1-tert-Butyl 2-methyl 4-methylenepyrrolidine-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 302.0±42.0 °C at 760 mmHg |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.284 |
| Flash Point | 136.4±27.9 °C |
| Exact Mass | 241.131409 |
| PSA | 55.84000 |
| LogP | 1.49 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.488 |
| InChIKey | CEEDNDKFZGTXOZ-VIFPVBQESA-N |
| SMILES | C=C1CC(C(=O)OC)N(C(=O)OC(C)(C)C)C1 |
| HS Code | 2933990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl 1-(2-methyl-2-propanyl) (2S)-4-methylene-1,2-pyrrolidinedicarboxylate |
| 1-O-tert-butyl 2-O-methyl (2S)-4-methylidenepyrrolidine-1,2-dicarboxylate |
| 1,2-Pyrrolidinedicarboxylic acid, 4-methylene-, 1-(1,1-dimethylethyl) 2-methyl ester, (2S)- |