9-methyl-10-nitroanthracene
Modify Date: 2025-09-21 11:54:30
9-methyl-10-nitroanthracene structure
|
Common Name | 9-methyl-10-nitroanthracene | ||
|---|---|---|---|---|
| CAS Number | 84457-22-7 | Molecular Weight | 237.25300 | |
| Density | 1.277g/cm3 | Boiling Point | 416.1ºC at 760 mmHg | |
| Molecular Formula | C15H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.3ºC | |
| Name | 9-methyl-10-nitroanthracene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.277g/cm3 |
|---|---|
| Boiling Point | 416.1ºC at 760 mmHg |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.25300 |
| Flash Point | 203.3ºC |
| Exact Mass | 237.07900 |
| PSA | 45.82000 |
| LogP | 4.73280 |
| Index of Refraction | 1.719 |
| InChIKey | FMIFGOKEBFQCGG-UHFFFAOYSA-N |
| SMILES | Cc1c2ccccc2c([N+](=O)[O-])c2ccccc12 |
| HS Code | 2904209090 |
|---|
|
~99%
9-methyl-10-nit... CAS#:84457-22-7 |
| Literature: Kaupp, Gerd; Schmeyers, Jens Journal of Organic Chemistry, 1995 , vol. 60, # 17 p. 5494 - 5503 |
|
~%
9-methyl-10-nit... CAS#:84457-22-7 |
| Literature: Armillotta, Nicola; Bartoli, Giuseppe; Bosco, Marcella; Dalpozzo, Renato Synthesis, 1982 , # 10 p. 836 - 839 |
CAS#:5447-86-9| HS Code | 2904209090 |
|---|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 10-nitro-9-methylanthracene |
| Anthracene,9-methyl-10-nitro |