4-(4-Methoxyphenyl)-1-(1-Methylethyl)Piperazine structure
|
Common Name | 4-(4-Methoxyphenyl)-1-(1-Methylethyl)Piperazine | ||
|---|---|---|---|---|
| CAS Number | 84499-46-7 | Molecular Weight | 234.33700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-methoxyphenyl)-4-propan-2-ylpiperazine |
|---|
| Molecular Formula | C14H22N2O |
|---|---|
| Molecular Weight | 234.33700 |
| Exact Mass | 234.17300 |
| PSA | 15.71000 |
| LogP | 2.22850 |
| InChIKey | VMCCWHRVXHFPSR-UHFFFAOYSA-N |
| SMILES | COc1ccc(N2CCN(C(C)C)CC2)cc1 |
| HS Code | 2933599090 |
|---|
|
~%
4-(4-Methoxyphe... CAS#:84499-46-7 |
| Literature: Heeres, J.; Hendrickx, R.; Cutsem, J.Van Journal of Medicinal Chemistry, 1983 , vol. 26, # 4 p. 611 - 613 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |