(4-tert-butylphenyl)-(3,4-difluorophenyl)methanone structure
|
Common Name | (4-tert-butylphenyl)-(3,4-difluorophenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 845781-01-3 | Molecular Weight | 274.30500 | |
| Density | 1.13g/cm3 | Boiling Point | 363.5ºC at 760 mmHg | |
| Molecular Formula | C17H16F2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139ºC | |
| Name | (4-tert-butylphenyl)-(3,4-difluorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 363.5ºC at 760 mmHg |
| Molecular Formula | C17H16F2O |
| Molecular Weight | 274.30500 |
| Flash Point | 139ºC |
| Exact Mass | 274.11700 |
| PSA | 17.07000 |
| LogP | 4.49330 |
| Index of Refraction | 1.525 |
| InChIKey | JVKNUIGIKMPSCH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(C(=O)c2ccc(F)c(F)c2)cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| PC2492 |
| (4-tert-butylphenyl)(3,4-difluorophenyl)methanone |
| 4-tert-Butyl-3',4'-difluorobenzophenone |