4-(1-BUTYL)-3',4'-DIFLUOROBENZOPHENONE structure
|
Common Name | 4-(1-BUTYL)-3',4'-DIFLUOROBENZOPHENONE | ||
|---|---|---|---|---|
| CAS Number | 845781-04-6 | Molecular Weight | 274.30500 | |
| Density | 1.134g/cm3 | Boiling Point | 377.2ºC at 760 mmHg | |
| Molecular Formula | C17H16F2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144ºC | |
| Name | (4-butylphenyl)-(3,4-difluorophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.134g/cm3 |
|---|---|
| Boiling Point | 377.2ºC at 760 mmHg |
| Molecular Formula | C17H16F2O |
| Molecular Weight | 274.30500 |
| Flash Point | 144ºC |
| Exact Mass | 274.11700 |
| PSA | 17.07000 |
| LogP | 4.53840 |
| Index of Refraction | 1.531 |
| InChIKey | PRQKSSOAHRWKSW-UHFFFAOYSA-N |
| SMILES | CCCCc1ccc(C(=O)c2ccc(F)c(F)c2)cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4-n-Butyl-3',4'-difluorobenzophenone |
| PC2486 |
| 4-butyl-3',4'-difluorobenzophenone |