1H-benzotriazole, compound with morpholine(1:1) structure
|
Common Name | 1H-benzotriazole, compound with morpholine(1:1) | ||
|---|---|---|---|---|
| CAS Number | 84604-74-0 | Molecular Weight | 206.24400 | |
| Density | N/A | Boiling Point | 450.9ºC at 760 mmHg | |
| Molecular Formula | C10H14N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.5ºC | |
| Name | 2H-benzotriazole,morpholine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 450.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.24400 |
| Flash Point | 226.5ºC |
| Exact Mass | 206.11700 |
| PSA | 62.83000 |
| LogP | 0.89290 |
| InChIKey | OZIKLUQNNGASRY-UHFFFAOYSA-N |
| SMILES | C1COCCN1.c1ccc2n[nH]nc2c1 |
|
~%
1H-benzotriazol... CAS#:84604-74-0 |
| Literature: Zonta, Cristiano; De Lucchi, Ottorino; Motterle, Riccardo; Serafini, Siro Journal of Physical Organic Chemistry, 2011 , vol. 24, # 2 p. 122 - 128 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| einecs 283-357-7 |