1-Methyl-1H-pyrazole-5-boronicacidpinacolester structure
|
Common Name | 1-Methyl-1H-pyrazole-5-boronicacidpinacolester | ||
|---|---|---|---|---|
| CAS Number | 847818-74-0 | Molecular Weight | 208.065 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 308.3±15.0 °C at 760 mmHg | |
| Molecular Formula | C10H17BN2O2 | Melting Point | 58-61°C | |
| MSDS | N/A | Flash Point | 140.3±20.4 °C | |
| Name | 1-Methyl-1H-pyrazole-5-boronic acid pinacol ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 308.3±15.0 °C at 760 mmHg |
| Melting Point | 58-61°C |
| Molecular Formula | C10H17BN2O2 |
| Molecular Weight | 208.065 |
| Flash Point | 140.3±20.4 °C |
| Exact Mass | 208.138306 |
| PSA | 36.28000 |
| LogP | 0.71930 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.505 |
| InChIKey | HLXOVAMYQUFLPE-UHFFFAOYSA-N |
| SMILES | Cn1nccc1B1OC(C)(C)C(C)(C)O1 |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R22 |
| Safety Phrases | S26 |
| HS Code | 2934999090 |
|
~79%
1-Methyl-1H-pyr... CAS#:847818-74-0 |
| Literature: WO2009/158374 A2, ; Page/Page column 30 ; WO 2009/158374 A2 |
|
~52%
1-Methyl-1H-pyr... CAS#:847818-74-0 |
| Literature: WO2007/120729 A2, ; Page/Page column 62-63 ; WO 2007/120729 A2 |
|
~85%
1-Methyl-1H-pyr... CAS#:847818-74-0 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 41, # 6 p. 931 - 939 |
|
~%
1-Methyl-1H-pyr... CAS#:847818-74-0 |
| Literature: US2012/316166 A1, ; Page/Page column 71 ; |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| MFCD05861380 |
| 1-Methyl-1H-pyrazole-5-boronicacidpinacolester |