N-(4-Chloro-3-cyano-7-ethoxy-6-quinolinyl)acetamide structure
|
Common Name | N-(4-Chloro-3-cyano-7-ethoxy-6-quinolinyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 848133-76-6 | Molecular Weight | 289.717 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 518.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H12ClN3O2 | Melting Point | 250°C(lit.) | |
| MSDS | N/A | Flash Point | 267.5±28.7 °C | |
| Name | N-(4-Chloro-3-cyano-7-ethoxy-6-quinolinyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 518.6±45.0 °C at 760 mmHg |
| Melting Point | 250°C(lit.) |
| Molecular Formula | C14H12ClN3O2 |
| Molecular Weight | 289.717 |
| Flash Point | 267.5±28.7 °C |
| Exact Mass | 289.061798 |
| PSA | 75.01000 |
| LogP | 2.34 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | XDXGFTCQRAQEEG-UHFFFAOYSA-N |
| SMILES | CCOc1cc2ncc(C#N)c(Cl)c2cc1NC(C)=O |
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(4-Chlor-3-cyan-7-ethoxychinolin-6-yl)acetamid |
| N-(4-Chloro-3-cyano-7-ethoxy-6-quinolinyl)acetamide |
| Acetamide, N-(4-chloro-3-cyano-7-ethoxy-6-quinolinyl)- |
| N-(4-chloro-3-cyano-7-ethoxyquinolin-6-yl)acetamide |