vasicinolone structure
|
Common Name | vasicinolone | ||
|---|---|---|---|---|
| CAS Number | 84847-50-7 | Molecular Weight | 218.21 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 506.8±60.0 °C at 760 mmHg | |
| Molecular Formula | C11H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.3±32.9 °C | |
Use of vasicinoloneVasicinolone, a natural alkaloid, exhibits anti-inflammatory and antimicrobial properties[1]. |
| Name | (3S)-3,7-dihydroxy-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-one |
|---|---|
| Synonym | More Synonyms |
| Description | Vasicinolone, a natural alkaloid, exhibits anti-inflammatory and antimicrobial properties[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 506.8±60.0 °C at 760 mmHg |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 |
| Flash Point | 260.3±32.9 °C |
| Exact Mass | 218.069138 |
| PSA | 75.35000 |
| LogP | -1.14 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.780 |
| InChIKey | MKNHUAILAQZBTQ-VIFPVBQESA-N |
| SMILES | O=c1c2cc(O)ccc2nc2n1CCC2O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyrrolo[2,1-b]quinazolin-9(1H)-one, 2,3-dihydro-3,7-dihydroxy-, (3S)- |
| Pyrrolo(2,1-b)quinazolin-9(1H)-one, 2,3-dihydro-3,7-dihydroxy-, (3S)- |
| (3S)-3,7-Dihydroxy-2,3-dihydropyrrolo[2,1-b]quinazolin-9(1H)-one |