7-hydroxy-3-phenyl-2-(trifluoromethyl)chromen-4-one structure
|
Common Name | 7-hydroxy-3-phenyl-2-(trifluoromethyl)chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 84858-65-1 | Molecular Weight | 306.23600 | |
| Density | 1.466g/cm3 | Boiling Point | 403.3ºC at 760 mmHg | |
| Molecular Formula | C16H9F3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.7ºC | |
| Name | 7-hydroxy-3-phenyl-2-(trifluoromethyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.466g/cm3 |
|---|---|
| Boiling Point | 403.3ºC at 760 mmHg |
| Molecular Formula | C16H9F3O3 |
| Molecular Weight | 306.23600 |
| Flash Point | 197.7ºC |
| Exact Mass | 306.05000 |
| PSA | 50.44000 |
| LogP | 4.18440 |
| Index of Refraction | 1.594 |
| InChIKey | IPYFSMBIYHJJOL-UHFFFAOYSA-N |
| SMILES | O=c1c(-c2ccccc2)c(C(F)(F)F)oc2cc(O)ccc12 |
| HS Code | 2914700090 |
|---|
|
~72%
7-hydroxy-3-phe... CAS#:84858-65-1 |
| Literature: Wu; Loch III; Toder; Borrelli; Gawlak; Radov; Gensmantel Journal of Medicinal Chemistry, 1992 , vol. 35, # 19 p. 3519 - 3525 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 7-hydroxy-2-trifluoromethylisoflavone |
| 7-Hydroxy-3-phenyl-2-trifluoromethyl-chromen-4-one |
| 7-hydroxy-3-phenyl-2-(trifluoromethyl)-4H-chromen-4-one |