2,2':5',2"-Terthiophene-5-boronic acid pinacol ester structure
|
Common Name | 2,2':5',2"-Terthiophene-5-boronic acid pinacol ester | ||
|---|---|---|---|---|
| CAS Number | 849062-17-5 | Molecular Weight | 374.34800 | |
| Density | 1.27g/cm3 | Boiling Point | 492.3ºC at 760 mmHg | |
| Molecular Formula | C18H19BO2S3 | Melting Point | 109-113ºC(lit.) | |
| MSDS | USA | Flash Point | 251.5ºC | |
| Name | 4,4,5,5-tetramethyl-2-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]-1,3,2-dioxaborolane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 492.3ºC at 760 mmHg |
| Melting Point | 109-113ºC(lit.) |
| Molecular Formula | C18H19BO2S3 |
| Molecular Weight | 374.34800 |
| Flash Point | 251.5ºC |
| Exact Mass | 374.06400 |
| PSA | 103.18000 |
| LogP | 5.50430 |
| Index of Refraction | 1.62 |
| InChIKey | FIUQKESHHZFUGG-UHFFFAOYSA-N |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(-c4cccs4)s3)s2)OC1(C)C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2934999090 |
|
~%
2,2':5',2"-Tert... CAS#:849062-17-5 |
| Literature: Wonneberger, Henrike; Ma, Chang-Qi; Gatys, Martina A.; Li, Chen; Baeuerle, Peter; Muellen, Klaus Journal of Physical Chemistry B, 2010 , vol. 114, # 45 p. 14343 - 14347 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,2':5',2"-Terthiophene-5-Boronic Acid Pinacol Ester |
| 2,2'-PIPERAZINE-1,4-DIYLBIS(IMINOACETONITRILE) |
| 2,2'-5',2"-terthiophene-5-boronic acid pinicolester |
| 5-(4,4,5,5-tetramethyl[1,3,2]dioxaborolan-2-yl)-2,2':5',2''-terthiophene |
| 2-([2,2':5',2''-Terthiophen]-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |