AMPK activator D942 structure
|
Common Name | AMPK activator D942 | ||
|---|---|---|---|---|
| CAS Number | 849727-81-7 | Molecular Weight | 368.398 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 538.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H21FO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.5±30.1 °C | |
Use of AMPK activator D942D942 is a cell penetrant AMPK activator and partially inhibits the mitochondrial complex I. In multiple myeloma cells, D942 inhibits cell growth[1]. |
| Name | 5-[3-[4-[2-(4-fluorophenyl)ethoxy]phenyl]propyl]furan-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | D942 is a cell penetrant AMPK activator and partially inhibits the mitochondrial complex I. In multiple myeloma cells, D942 inhibits cell growth[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 538.5±50.0 °C at 760 mmHg |
| Molecular Formula | C22H21FO4 |
| Molecular Weight | 368.398 |
| Flash Point | 279.5±30.1 °C |
| Exact Mass | 368.142395 |
| PSA | 59.67000 |
| LogP | 5.35 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | MPLLLQUZNJSVTK-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(CCCc2ccc(OCCc3ccc(F)cc3)cc2)o1 |
| AMPK Activator |
| 5-(3-{4-[2-(4-Fluorophenyl)ethoxy]phenyl}propyl)-2-furoic acid |
| IN1531 |
| 2-Furancarboxylic acid,5-[3-[4-[2-(4-fluorophenyl)ethoxy]phenyl]propyl] |
| D942 |
| 2-Furancarboxylic acid, 5-[3-[4-[2-(4-fluorophenyl)ethoxy]phenyl]propyl]- |
| 5-(3-(4-(2-(4-Fluorophenyl)ethoxy)phenyl)propyl)furan-2-carboxylic acid |