1-Ethyl-3-methylimidazolium Tetrachloroferrate structure
|
Common Name | 1-Ethyl-3-methylimidazolium Tetrachloroferrate | ||
|---|---|---|---|---|
| CAS Number | 850331-04-3 | Molecular Weight | 308.822 | |
| Density | 1.4580 g/cm3 (20.00℃ 0.3197 Torr) | Boiling Point | N/A | |
| Molecular Formula | C6H11Cl4FeN2 | Melting Point | 18℃ | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-Ethyl-3-methylimidazolium Tetrachloroferrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4580 g/cm3 (20.00℃ 0.3197 Torr) |
|---|---|
| Melting Point | 18℃ |
| Molecular Formula | C6H11Cl4FeN2 |
| Molecular Weight | 308.822 |
| Exact Mass | 306.902588 |
| PSA | 8.81000 |
| LogP | 3.08800 |
| InChIKey | VGSZFQMHQHFXCD-UHFFFAOYSA-J |
| SMILES | CCn1cc[n+](C)c1.Cl[Fe-](Cl)(Cl)Cl |
| Storage condition | 2-8℃ |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933290090 |
|
~%
1-Ethyl-3-methy... CAS#:850331-04-3 |
| Literature: EP2518055 A1, ; Page/Page column 12 ; |
|
~%
1-Ethyl-3-methy... CAS#:850331-04-3 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 78, # 11 p. 1921 - 1928 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-ethyl-3-methylimidazol-3-ium,tetrachloroiron(1-) |
| 1-Ethyl-3-methyl-1H-imidazol-3-ium tetrachloroferrate(1-) |