Bis-acrylate-PEG6
Modify Date: 2025-08-27 16:52:36
Bis-acrylate-PEG6 structure
|
Common Name | Bis-acrylate-PEG6 | ||
|---|---|---|---|---|
| CAS Number | 85136-58-9 | Molecular Weight | 390.42500 | |
| Density | 1.101g/cm3 | Boiling Point | 459.125ºC at 760 mmHg | |
| Molecular Formula | C18H30O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.816ºC | |
Use of Bis-acrylate-PEG6Bis-acrylate-PEG6 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-[2-[2-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Description | Bis-acrylate-PEG6 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.101g/cm3 |
|---|---|
| Boiling Point | 459.125ºC at 760 mmHg |
| Molecular Formula | C18H30O9 |
| Molecular Weight | 390.42500 |
| Flash Point | 196.816ºC |
| Exact Mass | 390.18900 |
| PSA | 98.75000 |
| LogP | 0.52780 |
| Index of Refraction | 1.46 |
| InChIKey | DMMSYVRRDYJQSI-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCOCCOCCOCCOCCOCCOC(=O)C=C |
| Hazard Codes | Xi |
|---|
| EINECS 285-782-3 |
| 2-Propenoic acid,1,1'-(3,6,9,12,15-pentaoxaheptadecane-1,17-diyl) ester |
| 2-Propenoicacid,3,6,9,12,15-pentaoxaheptadecane-1,17-diyl ester (9CI) |
| Hexaethyleneglycoldiacrylate |
| 3,6,9,12,15-Pentaoxaheptadecane-1,17-diyl diacrylate |