2H-3-Benzazepin-2-one, 3-(3-chloropropyl)-1,3,4,5-tetrahydro-7,8-dimethoxy- structure
|
Common Name | 2H-3-Benzazepin-2-one, 3-(3-chloropropyl)-1,3,4,5-tetrahydro-7,8-dimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 85175-65-1 | Molecular Weight | 297.777 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 476.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H20ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.8±28.7 °C | |
| Name | 3-(3-chloropropyl)-7,8-dimethoxy-2,5-dihydro-1H-3-benzazepin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 476.2±45.0 °C at 760 mmHg |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.777 |
| Flash Point | 241.8±28.7 °C |
| Exact Mass | 297.113159 |
| PSA | 38.77000 |
| LogP | 2.34 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | UKLLLQWDPVQNPO-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)CC(=O)N(CCCCl)CC2 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~88%
2H-3-Benzazepin... CAS#:85175-65-1 |
| Literature: Bomhard, Andreas; Reiffen, Manfred; Heider, Joachim; Psiorz, Manfred; Lillie, Christian Journal of Medicinal Chemistry, 1991 , vol. 34, # 3 p. 942 - 947 |
|
~88%
2H-3-Benzazepin... CAS#:85175-65-1 |
| Literature: Dr. Karl Thomae Gesellschaft mit beschrankter Haftung Patent: US4490369 A1, 1984 ; |
|
~%
2H-3-Benzazepin... CAS#:85175-65-1 |
| Literature: Dr. Karl Thomae Gesellschaft mit beschrankter Haftung Patent: US4490369 A1, 1984 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2H-3-Benzazepin-2-one,3-(3-chloropropyl)-1,3,4,5-tetrahydro-7,8-dimethoxy- |
| 3-(3-Chloropropyl)-7,8-dimethoxy-1,3,4,5-tetrahydro-2H-3-benzazepin-2-one |
| 2H-3-Benzazepin-2-one, 3-(3-chloropropyl)-1,3,4,5-tetrahydro-7,8-dimethoxy- |