TP-808 structure
|
Common Name | TP-808 | ||
|---|---|---|---|---|
| CAS Number | 852821-06-8 | Molecular Weight | 482.644 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 573.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C26H34N2O5Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 300.8±30.1 °C | |
Use of TP-808TP808 is a useful intermediate for the synthesis of diverse tetracycline antibiotics. |
| Name | (4aS,8aS,9S)-3-(benzyloxy)-4a-(tert-butyldimethylsilyloxy)-9-(dimethylamino)-8a,9-dihydronaphtho[2,3-d]isoxazole-4,5(4aH,8H)-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 573.8±50.0 °C at 760 mmHg |
| Molecular Formula | C26H34N2O5Si |
| Molecular Weight | 482.644 |
| Flash Point | 300.8±30.1 °C |
| Exact Mass | 482.223694 |
| PSA | 81.87000 |
| LogP | 4.59 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | SLXLVVLJLQJWFG-JCWFFFCVSA-N |
| SMILES | CN(C)C1c2onc(OCc3ccccc3)c2C(=O)C2(O[Si](C)(C)C(C)(C)C)C(=O)C=CCC12 |
| Naphth[2,3-d]isoxazole-4,5(4aH,8H)-dione, 9-(dimethylamino)-4a-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-8a,9-dihydro-3-(phenylmethoxy)-, (4aS,8aS,9S)- |
| (4aS,8aS,9S)-3-(Benzyloxy)-9-(dimethylamino)-4a-{[dimethyl(2-methyl-2-propanyl)silyl]oxy}-8a,9-dihydronaphtho[2,3-d][1,2]oxazole-4,5(4aH,8H)-dione |
| TP-808 |