(+)-5,6-O-CYCLOHEXYLIDENE-L-ASCORBICACID structure
|
Common Name | (+)-5,6-O-CYCLOHEXYLIDENE-L-ASCORBICACID | ||
|---|---|---|---|---|
| CAS Number | 85541-57-7 | Molecular Weight | 422.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H12F6O5 | Melting Point | 48ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (+)-α-Methoxy-α-(trifluoromethyl)phenylacetic Anhydride |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 48ºC |
|---|---|
| Molecular Formula | C18H12F6O5 |
| Molecular Weight | 422.27500 |
| Exact Mass | 422.05900 |
| PSA | 83.83000 |
| LogP | 2.95640 |
| Index of Refraction | 77.5 ° (C=2, CHCl3) |
| InChIKey | AATFPUCRBIXXID-UHFFFAOYSA-N |
| SMILES | COC(C(=O)OC(=O)C(OC)(c1ccccc1)C(F)(F)F)(c1ccccc1)C(F)(F)F |
| Storage condition | Refrigerator |
|
~%
(+)-5,6-O-CYCLO... CAS#:85541-57-7 |
| Literature: Yokokawa, Fumiaki; Izumi, Kentaro; Omata, Junko; Shioiri, Takayuki Tetrahedron, 2000 , vol. 56, # 19 p. 3027 - 3034 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl) 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |