4-Tert-butyldiphenyl sulfide structure
|
Common Name | 4-Tert-butyldiphenyl sulfide | ||
|---|---|---|---|---|
| CAS Number | 85609-03-6 | Molecular Weight | 242.379 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 352.6±21.0 °C at 760 mmHg | |
| Molecular Formula | C16H18S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.9±18.7 °C | |
| Name | 4-tert-Butyldiphenyl Sulfide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 352.6±21.0 °C at 760 mmHg |
| Molecular Formula | C16H18S |
| Molecular Weight | 242.379 |
| Flash Point | 158.9±18.7 °C |
| Exact Mass | 242.112915 |
| PSA | 25.30000 |
| LogP | 6.14 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | KGRAEJDVHXHGSQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(Sc2ccccc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R41:Risk of serious damage to eyes. R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S39 |
| WGK Germany | 3 |
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| 1-(2-Methyl-2-propanyl)-4-(phenylsulfanyl)benzene |
| Benzene, 1-(1,1-dimethylethyl)-4-(phenylthio)- |
| MFCD06200845 |
| 4-Tert-butyldiphenyl sulfide |
| 4-tert-Butylphenyl phenyl sulfide |
| 1-tert-Butyl-4-(phenylsulfanyl)benzene |
| 1-tert-butyl-4-phenylsulfanylbenzene |