2-Amino-4-(methoxycarbonyl)benzoic acid structure
|
Common Name | 2-Amino-4-(methoxycarbonyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 85743-02-8 | Molecular Weight | 195.172 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 397.7±32.0 °C at 760 mmHg | |
| Molecular Formula | C9H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.3±25.1 °C | |
| Name | 2-amino-4-methoxycarbonylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 397.7±32.0 °C at 760 mmHg |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.172 |
| Flash Point | 194.3±25.1 °C |
| Exact Mass | 195.053162 |
| PSA | 89.62000 |
| LogP | 1.72 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | WOLYDIFKLNALLS-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C(=O)O)c(N)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922509090 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 3-amino-4-carboxybenzoate |
| 1,4-Benzenedicarboxylic acid, 2-amino-, 4-methyl ester |
| 2-aminobenzene-1,4-dicarboxylic acid,4-methyl ester |
| Amino-terephthalsaeure-4-methylester |
| amino-terephthalic acid-4-methyl ester |
| 2-Amino-4-(methoxycarbonyl)benzoic acid |
| 2-aminoterephthalic acid 4-methyl ester |