ethyl 3,5-diiodo-4-(4-methoxyphenoxy)phenylacetate structure
|
Common Name | ethyl 3,5-diiodo-4-(4-methoxyphenoxy)phenylacetate | ||
|---|---|---|---|---|
| CAS Number | 85828-82-6 | Molecular Weight | 538.11500 | |
| Density | 1.808g/cm3 | Boiling Point | 479.5ºC at 760 mmHg | |
| Molecular Formula | C17H16I2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.8ºC | |
| Name | ethyl 2-[3,5-diiodo-4-(4-methoxyphenoxy)phenyl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.808g/cm3 |
|---|---|
| Boiling Point | 479.5ºC at 760 mmHg |
| Molecular Formula | C17H16I2O4 |
| Molecular Weight | 538.11500 |
| Flash Point | 243.8ºC |
| Exact Mass | 537.91400 |
| PSA | 44.76000 |
| LogP | 4.80230 |
| Index of Refraction | 1.629 |
| InChIKey | BCLWYRUGYYCELP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1cc(I)c(Oc2ccc(OC)cc2)c(I)c1 |
| HS Code | 2918990090 |
|---|
|
~66%
ethyl 3,5-diiod... CAS#:85828-82-6 |
| Literature: Bridoux, Alexandre; Khan, Riaz A.; Chen, Celei; Cheve, Gwenael; Cui, Huadong; Dyskin, Evgeny; Yasri, Aziz; Mousa, Shaker A. Journal of Enzyme Inhibition and Medicinal Chemistry, 2011 , vol. 26, # 6 p. 871 - 882 |
|
~%
ethyl 3,5-diiod... CAS#:85828-82-6 |
| Literature: VASCULAR VISION PHARMACEUTICAL COMPANY Patent: US2011/105482 A1, 2011 ; |
|
~%
ethyl 3,5-diiod... CAS#:85828-82-6 |
| Literature: VASCULAR VISION PHARMACEUTICAL COMPANY Patent: US2011/105482 A1, 2011 ; |
|
~%
ethyl 3,5-diiod... CAS#:85828-82-6 |
| Literature: VASCULAR VISION PHARMACEUTICAL COMPANY Patent: US2011/105482 A1, 2011 ; |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| [3,5-Dijod-4-(4-methoxy-phenoxy)-phenyl]-essigsaeure-aethylester |
| ethyl 3,5-diiodo-4-(4-methoxyphenoxy)phenylacetate |
| [3,5-diiodo-4-(4-methoxy-phenoxy)-phenyl]-acetic acid ethyl ester |
| EINECS 288-610-5 |