16alpha-Hydroxyprednisonlone Acetate structure
|
Common Name | 16alpha-Hydroxyprednisonlone Acetate | ||
|---|---|---|---|---|
| CAS Number | 86401-80-1 | Molecular Weight | 418.48000 | |
| Density | 1.34 | Boiling Point | 593.3ºC at 760 mmHg | |
| Molecular Formula | C23H30O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.5ºC | |
| Name | 16alpha-Hydroxyprednisonlone acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34 |
|---|---|
| Boiling Point | 593.3ºC at 760 mmHg |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.48000 |
| Flash Point | 202.5ºC |
| Exact Mass | 418.19900 |
| PSA | 121.13000 |
| LogP | 1.09920 |
| Index of Refraction | 1.629 |
| InChIKey | AAMGSJIEPUHTOK-YXKQBRRISA-N |
| SMILES | CC(=O)OCC(=O)C1(O)C(O)CC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC21C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918199090 |
|
~97%
16alpha-Hydroxy... CAS#:86401-80-1 |
| Literature: The Upjohn Company Patent: US5426198 A1, 1995 ; |
|
~%
16alpha-Hydroxy... CAS#:86401-80-1 |
| Literature: US5426198 A1, ; |
|
~%
16alpha-Hydroxy... CAS#:86401-80-1 |
| Literature: US5426198 A1, ; |
|
~%
16alpha-Hydroxy... CAS#:86401-80-1 |
| Literature: US2007/117974 A1, ; Page/Page column 4 ; |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 11b,16a,17 a,21-tetrahydroxylpregn-1,4diene-3,20-dione-21-acetate |
| 16ALPHA-HYDROXYPRENISOLONEACETATE |
| Pregna-1,4-diene-3,20-dione,21-(acetyloxy)-11,16,17-trihydroxy-,(11b,16a) |
| 16alpha-Hydroxy-prednisolone acetate |
| 11b,16a,17,21-tetrahydroxy-pregna-1,4-diene-3,20-dione 21-acetate |
| 16A-HYDROXY-PREDNISONLONE ACETATE |