Sequosempervirin B structure
|
Common Name | Sequosempervirin B | ||
|---|---|---|---|---|
| CAS Number | 864719-17-5 | Molecular Weight | 316.35 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 589.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310.0±30.1 °C | |
Use of Sequosempervirin BSequosempervirin B, a norlignan isolated from the branches and leaves of Sequoia sempervirens, has antifungal properties. Sequosempervirin B has an inhibitory effect on cyclic AMP phosphodiesterase[1]. |
| Name | Sequosempervirin B |
|---|---|
| Synonym | More Synonyms |
| Description | Sequosempervirin B, a norlignan isolated from the branches and leaves of Sequoia sempervirens, has antifungal properties. Sequosempervirin B has an inhibitory effect on cyclic AMP phosphodiesterase[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Zhang YM, et al. Norlignans from Sequoia sempervirens. Chem Biodivers. 2005 Apr;2(4):497-505. |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 589.0±50.0 °C at 760 mmHg |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 |
| Flash Point | 310.0±30.1 °C |
| Exact Mass | 316.131073 |
| PSA | 90.15000 |
| LogP | 0.94 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | JRWXFOFDIRHTQG-DOTOQJQBSA-N |
| SMILES | COc1cc(C(C=Cc2ccc(O)cc2)C(O)CO)ccc1O |
| Hazard Codes | Xi |
|---|
| (2S,3S,4E)-3-(4-Hydroxy-3-methoxyphenyl)-5-(4-hydroxyphenyl)-4-pentene-1,2-diol |
| 4-Pentene-1,2-diol, 3-(4-hydroxy-3-methoxyphenyl)-5-(4-hydroxyphenyl)-, (2S,3S,4E)- |