Methyl 4-piperazin-1-ylmethylbenzoate structure
|
Common Name | Methyl 4-piperazin-1-ylmethylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 86620-81-7 | Molecular Weight | 234.294 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 355.6±32.0 °C at 760 mmHg | |
| Molecular Formula | C13H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.9±25.1 °C | |
| Name | Methyl 4-piperazin-1-ylmethylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 355.6±32.0 °C at 760 mmHg |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.294 |
| Flash Point | 168.9±25.1 °C |
| Exact Mass | 234.136826 |
| PSA | 41.57000 |
| LogP | 1.34 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.545 |
| InChIKey | XJIVYTXCTMWGLR-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(CN2CCNCC2)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
|
~%
Methyl 4-pipera... CAS#:86620-81-7 |
| Literature: WO2006/113468 A2, ; Page/Page column 78 ; WO 2006/113468 A2 |
|
~%
Methyl 4-pipera... CAS#:86620-81-7 |
| Literature: US4616086 A1, ; |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 4-(piperazin-1-ylmethyl)benzoate |
| MFCD05861650 |
| Benzoic acid, 4-(1-piperazinylmethyl)-, methyl ester |
| Methyl 4-(1-piperazinylmethyl)benzoate |
| 4-(1-Piperaziyl methyl) benzoic acid methyl ester |