5-Chloro-3-((trimethylsilyl)ethynyl)pyridin-2-amine structure
|
Common Name | 5-Chloro-3-((trimethylsilyl)ethynyl)pyridin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 866318-90-3 | Molecular Weight | 224.76200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13ClN2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 5-chloro-3-(2-trimethylsilylethynyl)pyridin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13ClN2Si |
|---|---|
| Molecular Weight | 224.76200 |
| Exact Mass | 224.05400 |
| PSA | 38.91000 |
| LogP | 3.12730 |
| InChIKey | ZZSDHUMNIBZFFM-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#Cc1cc(Cl)cnc1N |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
|
~99%
5-Chloro-3-((tr... CAS#:866318-90-3 |
| Literature: VERTEX PHARMACEUTICALS INCORPORATED? Patent: WO2005/95400 A1, 2005 ; Location in patent: Page/Page column 345; 346 ; WO 2005/095400 A1 |
|
~%
5-Chloro-3-((tr... CAS#:866318-90-3 |
| Literature: WO2011/137022 A1, ; |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-chloro-3-(2-(trimethylsilyl)ethynyl)pyridin-2-amine |
| 5-chloro-3-trimethylsilanylethynylpyridin-2-ylamine |
| 5-chloro-3-[2-(trimethylsilyl)ethynyl]-2-pyridinamine |
| 2-amino-5-chloro-3-[(trimethylsilyl)ethynyl]pyridine |
| 2-AMINO-5-CHLORO-3-(TRIMETHYLSILYL)ACETYLENYLPYRIDINE |
| 5-Chloro-3-((trimethylsilyl)ethynyl)pyridin-2-amine |