tetrakis(4-(dimethylamino)phenyl)ethylene structure
|
Common Name | tetrakis(4-(dimethylamino)phenyl)ethylene | ||
|---|---|---|---|---|
| CAS Number | 86669-21-8 | Molecular Weight | 575.61400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H40Cl2N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,4'-{1,2-Bis[4-(dimethylamino)phenyl]-1,2-ethanediylidene}bis(N, N-dimethyl-2,5-cyclohexadien-1-iminium) dichloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C34H40Cl2N4 |
|---|---|
| Molecular Weight | 575.61400 |
| Exact Mass | 574.26300 |
| PSA | 12.50000 |
| InChIKey | QXTJLXJWYHGXFP-UHFFFAOYSA-L |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)C(=C2C=CC(=[N+](C)C)C=C2)c2ccc(N(C)C)cc2)cc1.[Cl-].[Cl-] |
| HS Code | 2921590090 |
|---|
|
~%
tetrakis(4-(dim... CAS#:86669-21-8 |
| Literature: Wizinger Chemische Berichte, 1927 , vol. 60, p. 1386 |
|
~%
tetrakis(4-(dim... CAS#:86669-21-8 |
| Literature: LePage, Gerald A.; Elofson, Richard M.; Schulz, Karlo F.; Laidler, James; Kowalewski, Konstanty P.; et al. Journal of Medicinal Chemistry, 1983 , vol. 26, # 11 p. 1645 - 1647 |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| tetrakis<p-(dimethylamino)phenyl>ethylene dichloride |
| Tetrakis-(4-chlor-phenyl)-aethylenglykol |
| Tetrakis-(4-dimethylamino-phenyl)-aethan-1,2-diol,Dichlorid |
| Tetrakis-(4-chlor-phenyl)-aethan-1,2-diol |
| 4.4'.4''.4'''-Tetrachlor-benzpinakon |
| 1,2-Dihydroxy-1,1,2,2-tetrakis-(4-chlor-phenyl)-aethan |
| tetrakis-(4-chloro-phenyl)-ethane-1,2-diol |
| tetrakis-(4-dimethylamino-phenyl)-ethane-1,2-diol,dichloride |