Benzenamine,4,4',4'',4'''-(1,2-ethenediylidene)tetrakis[N,N-dimethyl- structure
|
Common Name | Benzenamine,4,4',4'',4'''-(1,2-ethenediylidene)tetrakis[N,N-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 1261-86-5 | Molecular Weight | 504.70800 | |
| Density | 1.103g/cm3 | Boiling Point | 634ºC at 760mmHg | |
| Molecular Formula | C34H40N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.7ºC | |
| Name | N,N-dimethyl-4-[1,2,2-tris[4-(dimethylamino)phenyl]ethenyl]aniline |
|---|
| Density | 1.103g/cm3 |
|---|---|
| Boiling Point | 634ºC at 760mmHg |
| Molecular Formula | C34H40N4 |
| Molecular Weight | 504.70800 |
| Flash Point | 264.7ºC |
| Exact Mass | 504.32500 |
| PSA | 12.96000 |
| LogP | 6.95800 |
| Vapour Pressure | 5.57E-16mmHg at 25°C |
| Index of Refraction | 1.65 |
| InChIKey | PJZWENDBSVLVEB-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C(=C(c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)c2ccc(N(C)C)cc2)cc1 |
| HS Code | 2921590090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |